CAS 1142210-08-9
:1-[[5-[[(4-Chlorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid
Description:
1-[[5-[[(4-Chlorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid is a complex organic compound characterized by its multi-functional structure, which includes a thiadiazole ring, a piperidine moiety, and a chlorophenyl group. The presence of the thiadiazole ring suggests potential biological activity, as such heterocycles are often associated with pharmacological properties. The compound features multiple carbonyl groups, indicating it may participate in hydrogen bonding and other interactions, which can influence its solubility and reactivity. The piperidine ring contributes to its basicity and may affect its interaction with biological targets. Additionally, the chlorophenyl substituent can enhance lipophilicity, potentially impacting the compound's absorption and distribution in biological systems. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific properties such as solubility, melting point, and biological activity would require empirical investigation for comprehensive characterization.
Formula:C16H15ClN4O4S
InChI:InChI=1S/C16H15ClN4O4S/c17-10-3-5-11(6-4-10)18-12(22)13-19-20-14(26-13)15(23)21-7-1-2-9(8-21)16(24)25/h3-6,9H,1-2,7-8H2,(H,18,22)(H,24,25)
InChI key:InChIKey=RSLVJLXYZGJNIT-UHFFFAOYSA-N
SMILES:C(=O)(C=1SC(C(NC2=CC=C(Cl)C=C2)=O)=NN1)N3CC(C(O)=O)CCC3
Synonyms:- 3-Piperidinecarboxylic acid, 1-[[5-[[(4-chlorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-
- 1-[[5-[[(4-Chlorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.