CymitQuimica logo

CAS 1142210-14-7

:

1-[[4-(Ethoxycarbonyl)-3,5-dimethyl-1H-pyrrol-2-yl]carbonyl]-3-piperidinecarboxylic acid

Description:
1-[[4-(Ethoxycarbonyl)-3,5-dimethyl-1H-pyrrol-2-yl]carbonyl]-3-piperidinecarboxylic acid is a complex organic compound characterized by its multi-functional structure, which includes a pyrrole ring and a piperidine moiety. The presence of ethoxycarbonyl and carbonyl groups suggests that it exhibits both acidic and basic properties, making it potentially useful in various chemical reactions, including esterification and amidation. The dimethyl substitution on the pyrrole ring may influence its electronic properties and steric hindrance, affecting its reactivity and solubility. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its polar functional groups. Its unique structure may confer biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. Additionally, the presence of multiple functional groups allows for potential derivatization, which can be explored for enhancing its chemical properties or biological efficacy. Overall, this compound represents a versatile scaffold for further chemical exploration and application.
Formula:C16H22N2O5
InChI:InChI=1S/C16H22N2O5/c1-4-23-16(22)12-9(2)13(17-10(12)3)14(19)18-7-5-6-11(8-18)15(20)21/h11,17H,4-8H2,1-3H3,(H,20,21)
InChI key:InChIKey=YHOVAULAUBWDJA-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C(C(OCC)=O)=C(C)N1)N2CC(C(O)=O)CCC2
Synonyms:
  • 3-Piperidinecarboxylic acid, 1-[[4-(ethoxycarbonyl)-3,5-dimethyl-1H-pyrrol-2-yl]carbonyl]-
  • 1-[[4-(Ethoxycarbonyl)-3,5-dimethyl-1H-pyrrol-2-yl]carbonyl]-3-piperidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.