CAS 1142210-23-8
:1-[(5-Bromo-2-thienyl)sulfonyl]-α-methyl-4-piperidineacetic acid
Description:
1-[(5-Bromo-2-thienyl)sulfonyl]-α-methyl-4-piperidineacetic acid is a chemical compound characterized by its unique structural features, which include a piperidine ring, a thienyl group, and a sulfonyl moiety. The presence of the bromine atom on the thienyl ring enhances its reactivity and may influence its biological activity. This compound is likely to exhibit polar characteristics due to the sulfonyl group, which can engage in hydrogen bonding and increase solubility in polar solvents. The α-methyl group on the piperidine ring contributes to its steric properties, potentially affecting its interaction with biological targets. Additionally, the carboxylic acid functional group at the end of the piperidine chain may impart acidic properties, making it relevant in various chemical reactions and biological applications. Overall, this compound's structural complexity suggests potential utility in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.
Formula:C12H16BrNO4S2
InChI:InChI=1S/C12H16BrNO4S2/c1-8(12(15)16)9-4-6-14(7-5-9)20(17,18)11-3-2-10(13)19-11/h2-3,8-9H,4-7H2,1H3,(H,15,16)
InChI key:InChIKey=KRPGETIDKNWVIE-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1CCC(C(C(O)=O)C)CC1)C=2SC(Br)=CC2
Synonyms:- 4-Piperidineacetic acid, 1-[(5-bromo-2-thienyl)sulfonyl]-α-methyl-
- 1-[(5-Bromo-2-thienyl)sulfonyl]-α-methyl-4-piperidineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.