CAS 1142210-27-2
:4-[[1,4,6,7-Tetrahydro-1-methyl-3-(1-piperidinylcarbonyl)-5H-pyrazolo[4,3-c]pyridin-5-yl]methyl]benzoic acid
Description:
4-[[1,4,6,7-Tetrahydro-1-methyl-3-(1-piperidinylcarbonyl)-5H-pyrazolo[4,3-c]pyridin-5-yl]methyl]benzoic acid, identified by its CAS number 1142210-27-2, is a complex organic compound characterized by its multi-cyclic structure and functional groups. This substance features a benzoic acid moiety, which contributes to its acidic properties, and a pyrazolo-pyridine framework that may influence its biological activity. The presence of a piperidinylcarbonyl group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its tetrahydro structure indicates saturation, which can affect its solubility and reactivity. The compound's molecular weight, solubility in various solvents, and stability under different conditions are critical for its application in research and potential therapeutic uses. Additionally, the specific stereochemistry and substituents can significantly impact its pharmacokinetic and pharmacodynamic profiles. Overall, this compound's unique structural features position it as a candidate for further investigation in drug development and related fields.
Formula:C21H26N4O3
InChI:InChI=1S/C21H26N4O3/c1-23-18-9-12-24(13-15-5-7-16(8-6-15)21(27)28)14-17(18)19(22-23)20(26)25-10-3-2-4-11-25/h5-8H,2-4,9-14H2,1H3,(H,27,28)
InChI key:InChIKey=NGBKFVGYXMDZGZ-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(N(C)N1)CCN(CC3=CC=C(C(O)=O)C=C3)C2)N4CCCCC4
Synonyms:- Benzoic acid, 4-[[1,4,6,7-tetrahydro-1-methyl-3-(1-piperidinylcarbonyl)-5H-pyrazolo[4,3-c]pyridin-5-yl]methyl]-
- 4-[[1,4,6,7-Tetrahydro-1-methyl-3-(1-piperidinylcarbonyl)-5H-pyrazolo[4,3-c]pyridin-5-yl]methyl]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.