CymitQuimica logo

CAS 1142210-30-7

:

1-[[5-[[(4-Methoxyphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid

Description:
1-[[5-[[(4-Methoxyphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid is a complex organic compound characterized by its multi-functional structure, which includes a piperidine ring, a thiadiazole moiety, and a methoxyphenyl group. The presence of the thiadiazole ring suggests potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The methoxy group enhances the compound's lipophilicity, potentially influencing its solubility and permeability. The carboxylic acid functional group contributes to its acidity and can participate in hydrogen bonding, which may affect its interactions with biological targets. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, typical of many thiadiazole derivatives. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods like crystallization or chromatography. As with many complex organic molecules, its stability, reactivity, and potential applications would depend on the specific conditions under which it is studied.
Formula:C17H18N4O5S
InChI:InChI=1S/C17H18N4O5S/c1-26-12-6-4-11(5-7-12)18-13(22)14-19-20-15(27-14)16(23)21-8-2-3-10(9-21)17(24)25/h4-7,10H,2-3,8-9H2,1H3,(H,18,22)(H,24,25)
InChI key:InChIKey=GCOZTGRFAVBWBX-UHFFFAOYSA-N
SMILES:C(=O)(C=1SC(C(NC2=CC=C(OC)C=C2)=O)=NN1)N3CC(C(O)=O)CCC3
Synonyms:
  • 3-Piperidinecarboxylic acid, 1-[[5-[[(4-methoxyphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-
  • 1-[[5-[[(4-Methoxyphenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.