CAS 1142210-31-8

1-[(2,4-Dimethyl-5-thiazolyl)carbonyl]-4-piperidineacetic acid

Description:

1-[(2,4-Dimethyl-5-thiazolyl)carbonyl]-4-piperidineacetic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring and a thiazole moiety. The presence of the thiazole group contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. This compound features a carbonyl group attached to the thiazole, indicating it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. The piperidine ring, a six-membered nitrogen-containing heterocycle, adds to the compound's basicity and potential for forming salts. The acetic acid functional group suggests that the compound may exhibit acidic properties, which could influence its solubility and reactivity in different environments. Overall, the combination of these structural elements may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to fully elucidate its biological activity and potential applications.

Formula: C₁₃H₁₈N₂O₃S

InChI: InChI=1S/C13H18N2O3S/c1-8-12(19-9(2)14-8)13(18)15-5-3-10(4-6-15)7-11(16)17/h10H,3-7H2,1-2H3,(H,16,17)

InChI key: InChIKey=ZEAGNOLJDISZDX-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)N=C(C)S1)N2CCC(CC(O)=O)CC2

Synonyms:

• 4-Piperidineacetic acid, 1-[(2,4-dimethyl-5-thiazolyl)carbonyl]-
• 1-[(2,4-Dimethyl-5-thiazolyl)carbonyl]-4-piperidineacetic acid