CymitQuimica logo

CAS 1142210-40-9

:

1-[[4-(Acetylamino)phenyl]sulfonyl]-4-piperidineacetic acid

Description:
1-[[4-(Acetylamino)phenyl]sulfonyl]-4-piperidineacetic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring, an acetylamino group, and a sulfonyl moiety. This compound typically exhibits properties associated with both acidic and basic functional groups, allowing it to participate in various chemical reactions. It is likely to be soluble in polar solvents due to the presence of the sulfonyl and carboxylic acid functionalities. The compound may also demonstrate biological activity, potentially acting as a pharmaceutical agent, given its structural features that resemble those of known drug molecules. Its molecular interactions can be influenced by the presence of the acetylamino group, which may enhance its lipophilicity and affect its pharmacokinetic properties. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and drug development.
Formula:C15H20N2O5S
InChI:InChI=1S/C15H20N2O5S/c1-11(18)16-13-2-4-14(5-3-13)23(21,22)17-8-6-12(7-9-17)10-15(19)20/h2-5,12H,6-10H2,1H3,(H,16,18)(H,19,20)
InChI key:InChIKey=YOLAUWJAOBWSGU-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC=C(NC(C)=O)C=C1)N2CCC(CC(O)=O)CC2
Synonyms:
  • 4-Piperidineacetic acid, 1-[[4-(acetylamino)phenyl]sulfonyl]-
  • 1-[[4-(Acetylamino)phenyl]sulfonyl]-4-piperidineacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.