CAS 1142210-55-6
:1-[[5-[[(4-Fluorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid
Description:
1-[[5-[[(4-Fluorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid is a complex organic compound characterized by its unique structural features, which include a piperidine ring and a thiadiazole moiety. The presence of a fluorophenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the influence of fluorine on biological activity and lipophilicity. The compound contains multiple functional groups, including carboxylic acid and amide functionalities, which may contribute to its solubility and reactivity. Its molecular structure indicates potential for hydrogen bonding and interactions with biological targets, making it a candidate for further investigation in drug design. Additionally, the thiadiazole ring is known for its diverse biological activities, including antimicrobial and anti-inflammatory properties. Overall, this compound's intricate architecture and functional diversity position it as a subject of interest in chemical research and development.
Formula:C16H15FN4O4S
InChI:InChI=1S/C16H15FN4O4S/c17-10-3-5-11(6-4-10)18-12(22)13-19-20-14(26-13)15(23)21-7-1-2-9(8-21)16(24)25/h3-6,9H,1-2,7-8H2,(H,18,22)(H,24,25)
InChI key:InChIKey=WYXLMYBTYWBMMF-UHFFFAOYSA-N
SMILES:C(=O)(C=1SC(C(NC2=CC=C(F)C=C2)=O)=NN1)N3CC(C(O)=O)CCC3
Synonyms:- 1-[[5-[[(4-Fluorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-3-piperidinecarboxylic acid
- 3-Piperidinecarboxylic acid, 1-[[5-[[(4-fluorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]carbonyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.