CAS 1142210-57-8
:5-[[(4-Methoxyphenyl)amino]carbonyl]-1,3,4-thiadiazole-2-butanoic acid
Description:
5-[[(4-Methoxyphenyl)amino]carbonyl]-1,3,4-thiadiazole-2-butanoic acid is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, an amine group, and a carboxylic acid functionality. The presence of the 4-methoxyphenyl group contributes to its potential as a bioactive molecule, possibly influencing its solubility and interaction with biological targets. This compound may exhibit properties typical of thiadiazole derivatives, such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological activities would need to be confirmed through empirical studies. The carboxylic acid group suggests that it can participate in acid-base reactions, potentially affecting its reactivity and solubility in various solvents. Additionally, the methoxy group can enhance lipophilicity, which may influence the compound's pharmacokinetics. Overall, the characteristics of this compound make it of interest in medicinal chemistry and drug development, although further research is necessary to fully elucidate its properties and potential applications.
Formula:C14H15N3O4S
InChI:InChI=1S/C14H15N3O4S/c1-21-10-7-5-9(6-8-10)15-13(20)14-17-16-11(22-14)3-2-4-12(18)19/h5-8H,2-4H2,1H3,(H,15,20)(H,18,19)
InChI key:InChIKey=YMBMMPBSKQTCEZ-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(OC)C=C1)(=O)C=2SC(CCCC(O)=O)=NN2
Synonyms:- 1,3,4-Thiadiazole-2-butanoic acid, 5-[[(4-methoxyphenyl)amino]carbonyl]-
- 5-[[(4-Methoxyphenyl)amino]carbonyl]-1,3,4-thiadiazole-2-butanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.