CymitQuimica logo

CAS 1142210-61-4

:

N-Methyl-N-4-piperidinyl-4-morpholineethanamine

Description:
N-Methyl-N-4-piperidinyl-4-morpholineethanamine, identified by its CAS number 1142210-61-4, is a chemical compound that belongs to the class of amines. This substance features a complex structure that includes both piperidine and morpholine rings, contributing to its potential biological activity. It is characterized by its nitrogen-containing heterocycles, which can influence its solubility and reactivity. The presence of the N-methyl group suggests that it may exhibit specific pharmacological properties, potentially interacting with various biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could enhance binding affinity and selectivity for certain receptors. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, and safety data should be consulted to understand its handling and potential hazards. Overall, N-Methyl-N-4-piperidinyl-4-morpholineethanamine represents a compound with intriguing properties that warrant further investigation in both research and application contexts.
Formula:C12H25N3O
InChI:InChI=1S/C12H25N3O/c1-14(12-2-4-13-5-3-12)6-7-15-8-10-16-11-9-15/h12-13H,2-11H2,1H3
InChI key:InChIKey=QYKRHZNUFPPAIW-UHFFFAOYSA-N
SMILES:N(CCN1CCOCC1)(C)C2CCNCC2
Synonyms:
  • N-Methyl-N-4-piperidinyl-4-morpholineethanamine
  • 4-Morpholineethanamine, N-methyl-N-4-piperidinyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.