CAS 1142210-85-2
:5-(4-Fluorophenyl)-N-methyl-1,2,4-oxadiazole-3-ethanamine
Description:
5-(4-Fluorophenyl)-N-methyl-1,2,4-oxadiazole-3-ethanamine is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of a fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound features a methyl group attached to the nitrogen atom of the oxadiazole, which can affect its pharmacokinetic properties, such as absorption and distribution. The ethanamine side chain introduces basic amine functionality, which may play a role in receptor binding and solubility in aqueous environments. Overall, the combination of these structural elements suggests that this compound could exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific applications and effects would depend on further studies, including in vitro and in vivo evaluations, to elucidate its mechanism of action and therapeutic potential.
Formula:C11H12FN3O
InChI:InChI=1S/C11H12FN3O/c1-13-7-6-10-14-11(16-15-10)8-2-4-9(12)5-3-8/h2-5,13H,6-7H2,1H3
InChI key:InChIKey=KAFGVKAKENKLHZ-UHFFFAOYSA-N
SMILES:C(CNC)C=1N=C(ON1)C2=CC=C(F)C=C2
Synonyms:- 5-(4-Fluorophenyl)-N-methyl-1,2,4-oxadiazole-3-ethanamine
- 1,2,4-Oxadiazole-3-ethanamine, 5-(4-fluorophenyl)-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.