CymitQuimica logo

CAS 1142210-88-5

:

N-Methyl-5-(2-methylphenyl)-1,2,4-oxadiazole-3-ethanamine

Description:
N-Methyl-5-(2-methylphenyl)-1,2,4-oxadiazole-3-ethanamine is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of the N-methyl group enhances its lipophilicity, potentially influencing its ability to cross biological membranes. The 2-methylphenyl substituent may impart specific interactions with biological targets, making it of interest in medicinal chemistry. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its solubility and reactivity. Its oxadiazole moiety may also contribute to its stability and reactivity, particularly in relation to electrophilic and nucleophilic reactions. The compound's CAS number, 1142210-88-5, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data. Overall, N-Methyl-5-(2-methylphenyl)-1,2,4-oxadiazole-3-ethanamine represents a class of compounds that may have significant implications in pharmaceutical research and development.
Formula:C12H15N3O
InChI:InChI=1S/C12H15N3O/c1-9-5-3-4-6-10(9)12-14-11(15-16-12)7-8-13-2/h3-6,13H,7-8H2,1-2H3
InChI key:InChIKey=XVNRUKWVODFXIW-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1)C2=NC(CCNC)=NO2
Synonyms:
  • 1,2,4-Oxadiazole-3-ethanamine, N-methyl-5-(2-methylphenyl)-
  • N-Methyl-5-(2-methylphenyl)-1,2,4-oxadiazole-3-ethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.