CAS 1142210-90-9

2-Chloro-β-[3-(methoxymethoxy)phenyl]benzenepropanoic acid

Description:

2-Chloro-β-[3-(methoxymethoxy)phenyl]benzenepropanoic acid, with the CAS number 1142210-90-9, is a chemical compound characterized by its complex structure, which includes a chloro substituent and a methoxymethoxy group attached to a phenyl ring. This compound is part of the broader class of aromatic carboxylic acids, which typically exhibit moderate to high solubility in organic solvents and varying solubility in water, depending on the presence of polar functional groups. The chloro group can influence the compound's reactivity and potential biological activity, while the methoxymethoxy group may enhance lipophilicity and affect pharmacokinetic properties. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The presence of multiple functional groups suggests that this compound may participate in various chemical reactions, including nucleophilic substitutions and esterifications. Overall, the unique combination of substituents in this molecule contributes to its potential utility in diverse chemical and biological contexts.

Formula: C₁₇H₁₇ClO₄

InChI: InChI=1S/C17H17ClO4/c1-21-11-22-13-6-4-5-12(9-13)15(10-17(19)20)14-7-2-3-8-16(14)18/h2-9,15H,10-11H2,1H3,(H,19,20)

InChI key: InChIKey=MAJRHDUTXUVEOK-UHFFFAOYSA-N

SMILES: C(CC(O)=O)(C1=CC(OCOC)=CC=C1)C2=C(Cl)C=CC=C2

Synonyms:

• Benzenepropanoic acid, 2-chloro-β-[3-(methoxymethoxy)phenyl]-
• 2-Chloro-β-[3-(methoxymethoxy)phenyl]benzenepropanoic acid