CAS 1142211-05-9
:Methyl 6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate
Description:
Methyl 6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate is a chemical compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates a chloroethyl substituent. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the chloroethyl group suggests that it may exhibit biological activity, possibly interacting with various biological targets. The pyrazolo[1,5-a]pyrimidine framework is known for its applications in medicinal chemistry, particularly in the development of pharmaceuticals. The methyl ester group enhances its lipophilicity, which can influence its absorption and distribution in biological systems. Additionally, the compound's molecular structure may allow for various synthetic modifications, making it a versatile intermediate in organic synthesis. Overall, Methyl 6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate represents a significant compound of interest in both research and potential therapeutic applications.
Formula:C10H10ClN3O2
InChI:InChI=1S/C10H10ClN3O2/c1-16-10(15)8-4-9-12-5-7(2-3-11)6-14(9)13-8/h4-6H,2-3H2,1H3
InChI key:InChIKey=UBPOADLMYHAAET-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=NN2C(=C1)N=CC(CCCl)=C2
Synonyms:- Methyl 6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate
- Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 6-(2-chloroethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.