CAS 1142211-08-2

Methyl 5-(2-furanyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate

Description:

Methyl 5-(2-furanyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a pyrazolo-pyrimidine core fused with a furan ring and a trifluoromethyl group. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of the trifluoromethyl group, which can enhance its biological activity and solubility in organic solvents. The methyl ester functional group contributes to its reactivity, making it a potential candidate for further chemical modifications. Additionally, the presence of the furan moiety may impart unique electronic properties and potential interactions in biological systems. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications, including anti-inflammatory or anticancer activities. As with many heterocyclic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups.

Formula: C₁₃H₈F₃N₃O₃

InChI: InChI=1S/C13H8F3N3O3/c1-21-12(20)8-6-11-17-7(9-3-2-4-22-9)5-10(13(14,15)16)19(11)18-8/h2-6H,1H3

InChI key: InChIKey=PKCGMUPDJHRMFW-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N2C(N=C(C1)C3=CC=CO3)=CC(C(OC)=O)=N2

Synonyms:

• Methyl 5-(2-furanyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate
• Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 5-(2-furanyl)-7-(trifluoromethyl)-, methyl ester