CAS 1142211-14-0

2,3-Dihydro-6-[(1-methylethyl)amino]-1,4-phthalazinedione

Description:

2,3-Dihydro-6-[(1-methylethyl)amino]-1,4-phthalazinedione, identified by its CAS number 1142211-14-0, is a chemical compound characterized by its phthalazine core structure, which is a bicyclic compound containing nitrogen atoms. This substance features a dihydro configuration, indicating the presence of two hydrogen atoms that contribute to its saturation. The compound also contains an isopropylamino group, which enhances its potential for biological activity. Typically, phthalazinediones exhibit properties such as being solid at room temperature and may have moderate solubility in organic solvents. The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry and drug development. Its unique structure may impart specific pharmacological properties, although detailed studies would be necessary to elucidate its biological effects and applications. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, making it a candidate for further research in various chemical and pharmaceutical contexts.

Formula: C₁₁H₁₃N₃O₂

InChI: InChI=1S/C11H13N3O2/c1-6(2)12-7-3-4-8-9(5-7)11(16)14-13-10(8)15/h3-6,12H,1-2H3,(H,13,15)(H,14,16)

InChI key: InChIKey=XSPKXSWVASUVIG-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)NN1)=CC=C(NC(C)C)C2

Synonyms:

• 1,4-Phthalazinedione, 2,3-dihydro-6-[(1-methylethyl)amino]-
• 2,3-Dihydro-6-[(1-methylethyl)amino]-1,4-phthalazinedione