CAS 1142211-19-5

2-[[1-(Hydroxymethyl)cyclobutyl]methyl]-1H-isoindole-1,3(2H)-dione

Description:

2-[[1-(Hydroxymethyl)cyclobutyl]methyl]-1H-isoindole-1,3(2H)-dione, identified by its CAS number 1142211-19-5, is a chemical compound that features a complex structure characterized by the presence of an isoindole moiety and a cyclobutyl group. This compound typically exhibits properties associated with both cyclic and aromatic systems, which may influence its reactivity and stability. The hydroxymethyl group contributes to its potential for hydrogen bonding, enhancing solubility in polar solvents. The isoindole structure suggests potential biological activity, as many isoindole derivatives are known for their pharmacological properties. Additionally, the presence of multiple functional groups may allow for various chemical modifications, making it a candidate for further research in medicinal chemistry. Its specific applications and behavior in chemical reactions would depend on the context of its use, including potential interactions with biological targets or other chemical species. Overall, this compound represents a unique intersection of structural features that may be of interest in both synthetic and applied chemistry.

Formula: C₁₄H₁₅NO₃

InChI: InChI=1S/C14H15NO3/c16-9-14(6-3-7-14)8-15-12(17)10-4-1-2-5-11(10)13(15)18/h1-2,4-5,16H,3,6-9H2

InChI key: InChIKey=LHGLDKJTMYLNII-UHFFFAOYSA-N

SMILES: C(N1C(=O)C=2C(C1=O)=CC=CC2)C3(CO)CCC3

Synonyms:

• 2-[[1-(Hydroxymethyl)cyclobutyl]methyl]-1H-isoindole-1,3(2H)-dione
• 1H-Isoindole-1,3(2H)-dione, 2-[[1-(hydroxymethyl)cyclobutyl]methyl]-
• 1H-isoindole-1,3(2H)-dione, 2-[[1-(hydroxymethyl)cyclobuty