CAS 1142211-21-9

[1-[[(1,1-Dimethylethoxy)carbonyl]amino]cyclobutyl]methyl 1,1-dimethylethyl carbonate

Description:

The chemical substance known as "[1-[[(1,1-Dimethylethoxy)carbonyl]amino]cyclobutyl]methyl 1,1-dimethylethyl carbonate" with CAS number 1142211-21-9 is a complex organic compound characterized by its unique structural features. It contains a cyclobutyl group, which is a four-membered carbon ring, and is substituted with a dimethylethoxycarbonyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of carbonate functionality suggests that it may participate in reactions typical of esters, such as hydrolysis or transesterification. This compound is likely to exhibit moderate polarity due to the presence of both hydrophobic (alkyl groups) and hydrophilic (carbonyl and ether functionalities) elements. Its molecular structure implies potential uses in medicinal chemistry or as an intermediate in the synthesis of more complex molecules. However, specific physical properties such as boiling point, melting point, and solubility would need to be determined experimentally or sourced from reliable databases for comprehensive characterization.

Formula: C₁₅H₂₇NO₅

InChI: InChI=1S/C15H27NO5/c1-13(2,3)20-11(17)16-15(8-7-9-15)10-19-12(18)21-14(4,5)6/h7-10H2,1-6H3,(H,16,17)

InChI key: InChIKey=FNYPNRSCMNVOAU-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1(COC(OC(C)(C)C)=O)CCC1

Synonyms:

• [1-[[(1,1-Dimethylethoxy)carbonyl]amino]cyclobutyl]methyl 1,1-dimethylethyl carbonate
• Carbonic acid, [1-[[(1,1-dimethylethoxy)carbonyl]amino]cyclobutyl]methyl 1,1-dimethylethyl ester
• {1-[(tert-butoxycarbonyl)amino]cyclobutyl}methyl tert-butyl carbonate
• tert-Butyl (1-(((tert-butoxycarbonyl)oxy)methyl)cyclobutyl)carbamate
• carbonic acid, [1-[[(1,1-dimethylethoxy)carbonyl]amino]cyc