CymitQuimica logo

CAS 1142211-47-9

:

N-[2-[4-(2-Fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-phenylglycine

Description:
N-[2-[4-(2-Fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-phenylglycine, with the CAS number 1142211-47-9, is a chemical compound that belongs to the class of amino acids and derivatives. It features a piperazine ring, which is a common structural motif in many pharmaceuticals, contributing to its biological activity. The presence of a fluorophenyl group suggests potential lipophilicity, which may enhance its ability to cross biological membranes. This compound is characterized by its dual functional groups: an amino group and a carboxylic acid moiety, which are typical of amino acids, allowing for potential interactions in biological systems. Its structure indicates that it may exhibit properties relevant to neuropharmacology, possibly acting as a modulator of neurotransmitter systems. Additionally, the compound's unique substituents may influence its solubility, stability, and reactivity, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its specific biological activities and therapeutic potential.
Formula:C20H22FN3O3
InChI:InChI=1S/C20H22FN3O3/c21-17-8-4-5-9-18(17)22-10-12-23(13-11-22)19(25)14-24(15-20(26)27)16-6-2-1-3-7-16/h1-9H,10-15H2,(H,26,27)
InChI key:InChIKey=RCTCQJFMXIOCQN-UHFFFAOYSA-N
SMILES:FC1=C(N2CCN(C(CN(CC(O)=O)C3=CC=CC=C3)=O)CC2)C=CC=C1
Synonyms:
  • Glycine, N-[2-[4-(2-fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-phenyl-
  • N-[2-[4-(2-Fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-phenylglycine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.