CAS 1142211-50-4

N-[2-[4-(4-Fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-phenylglycine

Description:

N-[2-[4-(4-Fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-phenylglycine, with CAS number 1142211-50-4, is a chemical compound characterized by its complex structure, which includes a piperazine ring and a phenylglycine moiety. This substance typically exhibits properties associated with both amines and carboxylic acids due to the presence of the piperazine and glycine functional groups. It is likely to be a solid at room temperature and may have moderate solubility in polar solvents, reflecting its potential for interaction with biological systems. The fluorine atom in the para position of the phenyl ring can influence its electronic properties, potentially enhancing its biological activity or altering its pharmacokinetic profile. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of psychiatry and neurology, due to their ability to interact with neurotransmitter systems. As with many chemical substances, safety data and handling precautions should be observed, as the specific biological effects and toxicity profiles would depend on further empirical studies.

Formula: C₂₀H₂₂FN₃O₃

InChI: InChI=1S/C20H22FN3O3/c21-16-6-8-18(9-7-16)22-10-12-23(13-11-22)19(25)14-24(15-20(26)27)17-4-2-1-3-5-17/h1-9H,10-15H2,(H,26,27)

InChI key: InChIKey=HONXSSHIMGIURO-UHFFFAOYSA-N

SMILES: N(CC(=O)N1CCN(CC1)C2=CC=C(F)C=C2)(CC(O)=O)C3=CC=CC=C3

Synonyms:

• Glycine, N-[2-[4-(4-fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-phenyl-
• N-[2-[4-(4-Fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-phenylglycine