CAS 1142211-53-7
:N-[2-Oxo-2-[4-(2-pyrimidinyl)-1-piperazinyl]ethyl]-N-phenylglycine
Description:
N-[2-Oxo-2-[4-(2-pyrimidinyl)-1-piperazinyl]ethyl]-N-phenylglycine, with the CAS number 1142211-53-7, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a phenylglycine backbone, which is modified with a piperazine ring and a pyrimidine moiety, contributing to its potential biological activity. The presence of the 2-oxo group indicates that it may participate in various chemical reactions, including those involving nucleophiles. The compound is likely to exhibit polar characteristics due to the presence of functional groups, which may influence its solubility in water and organic solvents. Its structural complexity suggests potential interactions with biological targets, making it of interest in medicinal chemistry and pharmacology. Additionally, the piperazine and pyrimidine components may impart specific pharmacological properties, such as receptor binding or enzyme inhibition. Overall, this compound's unique structure positions it as a candidate for further research in drug development and therapeutic applications.
Formula:C18H21N5O3
InChI:InChI=1S/C18H21N5O3/c24-16(13-23(14-17(25)26)15-5-2-1-3-6-15)21-9-11-22(12-10-21)18-19-7-4-8-20-18/h1-8H,9-14H2,(H,25,26)
InChI key:InChIKey=KGDFXDVEVNIFPX-UHFFFAOYSA-N
SMILES:C(CN(CC(O)=O)C1=CC=CC=C1)(=O)N2CCN(CC2)C=3N=CC=CN3
Synonyms:- Glycine, N-[2-oxo-2-[4-(2-pyrimidinyl)-1-piperazinyl]ethyl]-N-phenyl-
- N-[2-Oxo-2-[4-(2-pyrimidinyl)-1-piperazinyl]ethyl]-N-phenylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.