CAS 1142211-55-9

N-[2-Oxo-2-[4-(2-pyridinyl)-1-piperazinyl]ethyl]-N-phenylglycine

Description:

N-[2-Oxo-2-[4-(2-pyridinyl)-1-piperazinyl]ethyl]-N-phenylglycine, identified by its CAS number 1142211-55-9, is a chemical compound that features a complex structure incorporating both a glycine moiety and a piperazine ring. This compound is characterized by its potential biological activity, often explored in pharmacological contexts. The presence of the pyridine and piperazine groups suggests that it may interact with various biological targets, possibly influencing neurotransmitter systems or exhibiting other pharmacodynamic properties. The oxo group contributes to its reactivity and may play a role in its mechanism of action. As a derivative of glycine, it may also exhibit properties related to amino acids, such as involvement in protein synthesis or modulation of receptor activity. Its solubility, stability, and specific interactions would depend on the surrounding conditions, including pH and solvent polarity. Overall, this compound represents a class of molecules that could be of interest in medicinal chemistry and drug development.

Formula: C₁₉H₂₂N₄O₃

InChI: InChI=1S/C19H22N4O3/c24-18(14-23(15-19(25)26)16-6-2-1-3-7-16)22-12-10-21(11-13-22)17-8-4-5-9-20-17/h1-9H,10-15H2,(H,25,26)

InChI key: InChIKey=HPKDEKSRVJINQP-UHFFFAOYSA-N

SMILES: C(CN(CC(O)=O)C1=CC=CC=C1)(=O)N2CCN(CC2)C3=CC=CC=N3

Synonyms:

• N-[2-Oxo-2-[4-(2-pyridinyl)-1-piperazinyl]ethyl]-N-phenylglycine
• Glycine, N-[2-oxo-2-[4-(2-pyridinyl)-1-piperazinyl]ethyl]-N-phenyl-