
CAS 1142211-76-4
:N-[2-(4-Morpholinyl)-2-oxoethyl]-N-phenylglycine
Description:
N-[2-(4-Morpholinyl)-2-oxoethyl]-N-phenylglycine, identified by its CAS number 1142211-76-4, is a chemical compound that features a morpholine ring, which contributes to its potential biological activity. This substance is characterized by the presence of both an amine and a carboxylic acid functional group, making it an amino acid derivative. The morpholine moiety enhances its solubility and may influence its interaction with biological targets. The compound is typically studied for its potential pharmacological properties, particularly in the context of drug development. Its structure suggests that it may exhibit properties such as moderate polarity and the ability to form hydrogen bonds, which are crucial for its interaction with biological systems. Additionally, the presence of the phenyl group may contribute to its lipophilicity, affecting its absorption and distribution in biological environments. Overall, N-[2-(4-Morpholinyl)-2-oxoethyl]-N-phenylglycine represents a class of compounds that may have significant implications in medicinal chemistry and therapeutic applications.
Formula:C14H18N2O4
InChI:InChI=1S/C14H18N2O4/c17-13(15-6-8-20-9-7-15)10-16(11-14(18)19)12-4-2-1-3-5-12/h1-5H,6-11H2,(H,18,19)
InChI key:InChIKey=SAARZLVBWMPPAC-UHFFFAOYSA-N
SMILES:N(CC(=O)N1CCOCC1)(CC(O)=O)C2=CC=CC=C2
Synonyms:- Glycine, N-[2-(4-morpholinyl)-2-oxoethyl]-N-phenyl-
- N-[2-(4-Morpholinyl)-2-oxoethyl]-N-phenylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.