CAS 1142211-87-7
:N-[2-(3,4-Dihydro-2(1H)-isoquinolinyl)-2-oxoethyl]-N-phenylglycine
Description:
N-[2-(3,4-Dihydro-2(1H)-isoquinolinyl)-2-oxoethyl]-N-phenylglycine, with the CAS number 1142211-87-7, is a chemical compound that features a complex structure incorporating both isoquinoline and glycine moieties. This compound is characterized by its potential biological activity, which may include interactions with various biological targets, making it of interest in medicinal chemistry. The presence of the isoquinoline ring suggests possible pharmacological properties, as isoquinolines are known for their diverse biological activities, including analgesic and anti-inflammatory effects. The glycine component may contribute to its solubility and interaction with biological systems. Additionally, the compound's structure indicates it may participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature typically exhibit moderate to high lipophilicity, which can affect their bioavailability and distribution in biological systems. Further studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C19H20N2O3
InChI:InChI=1S/C19H20N2O3/c22-18(20-11-10-15-6-4-5-7-16(15)12-20)13-21(14-19(23)24)17-8-2-1-3-9-17/h1-9H,10-14H2,(H,23,24)
InChI key:InChIKey=FRENBRDXBUWCPF-UHFFFAOYSA-N
SMILES:C(CN(CC(O)=O)C1=CC=CC=C1)(=O)N2CC=3C(CC2)=CC=CC3
Synonyms:- Glycine, N-[2-(3,4-dihydro-2(1H)-isoquinolinyl)-2-oxoethyl]-N-phenyl-
- N-[2-(3,4-Dihydro-2(1H)-isoquinolinyl)-2-oxoethyl]-N-phenylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.