CAS 1142211-96-8
:N-[2-(2-Methyl-1-piperidinyl)-2-oxoethyl]-N-phenylglycine
Description:
N-[2-(2-Methyl-1-piperidinyl)-2-oxoethyl]-N-phenylglycine, with the CAS number 1142211-96-8, is a chemical compound characterized by its unique structure that includes a phenyl group, a piperidine moiety, and a glycine derivative. This compound typically exhibits properties associated with both amines and carboxylic acids due to the presence of the amino acid structure. It is likely to be a solid at room temperature, with potential solubility in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. The piperidine ring contributes to its basicity, while the phenyl group may enhance lipophilicity, influencing its biological activity and interaction with various receptors. Such compounds are often studied for their potential pharmacological applications, particularly in the fields of neuroscience and medicinal chemistry, where they may act as modulators of neurotransmitter systems. However, specific physical and chemical properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C16H22N2O3
InChI:InChI=1S/C16H22N2O3/c1-13-7-5-6-10-18(13)15(19)11-17(12-16(20)21)14-8-3-2-4-9-14/h2-4,8-9,13H,5-7,10-12H2,1H3,(H,20,21)
InChI key:InChIKey=RHKYAWSMIVXMQP-UHFFFAOYSA-N
SMILES:N(CC(=O)N1C(C)CCCC1)(CC(O)=O)C2=CC=CC=C2
Synonyms:- Glycine, N-[2-(2-methyl-1-piperidinyl)-2-oxoethyl]-N-phenyl-
- N-[2-(2-Methyl-1-piperidinyl)-2-oxoethyl]-N-phenylglycine
- [[2-(2-methylpiperidin-1-yl)-2-oxoethyl](phenyl)amino]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.