CAS 1142214-33-2

2-(2-Benzothiazolyl)cyclopropanecarboxylic acid

Description:

2-(2-Benzothiazolyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a benzothiazole moiety and a cyclopropane ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may act as a weak acid. Additionally, the benzothiazole ring can impart biological activity, making this compound of interest in medicinal chemistry and material science. Its molecular structure may influence solubility, melting point, and other physical properties, which are essential for applications in pharmaceuticals or agrochemicals. The compound's CAS number, 1142214-33-2, allows for precise identification and retrieval of information in chemical databases, facilitating research and development efforts. Overall, 2-(2-Benzothiazolyl)cyclopropanecarboxylic acid represents a versatile structure with potential applications in various fields of chemistry.

Formula: C₁₁H₉NO₂S

InChI: InChI=1S/C11H9NO2S/c13-11(14)7-5-6(7)10-12-8-3-1-2-4-9(8)15-10/h1-4,6-7H,5H2,(H,13,14)

InChI key: InChIKey=QENQUKIOSLLIGG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C(C1)C2=NC=3C(S2)=CC=CC3

Synonyms:

• 2-(2-Benzothiazolyl)cyclopropanecarboxylic acid
• Cyclopropanecarboxylic acid, 2-(2-benzothiazolyl)-