
CAS 1142214-36-5
:2-(2-Benzoxazolyl)cyclopropanecarboxylic acid
Description:
2-(2-Benzoxazolyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a benzoxazole moiety fused to a cyclopropane ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions, potentially acting as a weak acid. Its benzoxazole component may impart biological activity, making it of interest in medicinal chemistry and drug development. The compound is likely to be soluble in organic solvents, while its solubility in water may vary depending on the pH. Additionally, the structural features may influence its interaction with biological targets, leading to various applications in pharmaceuticals or agrochemicals. As with many organic compounds, safety data should be consulted to understand its handling and toxicity. Overall, 2-(2-Benzoxazolyl)cyclopropanecarboxylic acid represents a versatile structure with potential implications in various chemical and biological fields.
Formula:C11H9NO3
InChI:InChI=1S/C11H9NO3/c13-11(14)7-5-6(7)10-12-8-3-1-2-4-9(8)15-10/h1-4,6-7H,5H2,(H,13,14)
InChI key:InChIKey=ZZTHDEKCVGNAJD-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(C1)C2=NC=3C(O2)=CC=CC3
Synonyms:- Cyclopropanecarboxylic acid, 2-(2-benzoxazolyl)-
- 2-(2-Benzoxazolyl)cyclopropanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.