CAS 1142214-40-1

3-[[(2-Hydroxyphenyl)amino]carbonyl]-2,2-dimethylcyclopropanecarboxylic acid

Description:

3-[[(2-Hydroxyphenyl)amino]carbonyl]-2,2-dimethylcyclopropanecarboxylic acid, with the CAS number 1142214-40-1, is a chemical compound characterized by its unique structural features, including a cyclopropane ring and an amino acid derivative. This compound contains a hydroxyl group attached to a phenyl ring, which contributes to its potential for hydrogen bonding and influences its solubility and reactivity. The presence of the carboxylic acid functional group indicates acidic properties, while the dimethyl substitution on the cyclopropane enhances steric hindrance, potentially affecting its biological activity and interactions. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular environment and conditions. Overall, this compound represents a complex structure that could be explored for various applications in drug development and organic synthesis.

Formula: C₁₃H₁₅NO₄

InChI: InChI=1S/C13H15NO4/c1-13(2)9(10(13)12(17)18)11(16)14-7-5-3-4-6-8(7)15/h3-6,9-10,15H,1-2H3,(H,14,16)(H,17,18)

InChI key: InChIKey=DXAGQZHCBYSYJF-UHFFFAOYSA-N

SMILES: C(NC1=C(O)C=CC=C1)(=O)C2C(C(O)=O)C2(C)C

Synonyms:

• Cyclopropanecarboxylic acid, 3-[[(2-hydroxyphenyl)amino]carbonyl]-2,2-dimethyl-
• 3-[[(2-Hydroxyphenyl)amino]carbonyl]-2,2-dimethylcyclopropanecarboxylic acid