CAS 1142214-49-0

1H-Indole-2,3-dione, 3-[2-(2-hydroxyethyl)hydrazone]

Description:

1H-Indole-2,3-dione, 3-[2-(2-hydroxyethyl)hydrazone] is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of the 2,3-dione functional groups indicates that it contains two carbonyl groups, contributing to its reactivity and potential biological activity. The hydrazone moiety, formed from the reaction of a hydrazine derivative with a carbonyl compound, suggests that this substance may exhibit properties related to hydrazones, such as potential antimicrobial or anticancer activities. The hydroxyethyl substituent enhances its solubility in polar solvents, which may influence its biological interactions. This compound may be of interest in medicinal chemistry and drug development due to its structural features that could interact with biological targets. However, specific data regarding its physical properties, stability, and reactivity would require further investigation through experimental studies or literature review.

Formula: C₁₀H₁₁N₃O₂

InChI: InChI=1S/C10H11N3O2/c14-6-5-11-13-9-7-3-1-2-4-8(7)12-10(9)15/h1-4,11,14H,5-6H2,(H,12,13,15)

InChI key: InChIKey=YDWZRIFCEPGCJG-UHFFFAOYSA-N

SMILES: N(NCCO)=C1C=2C(NC1=O)=CC=CC2

Synonyms:

• 1H-Indole-2,3-dione, 3-[2-(2-hydroxyethyl)hydrazone]