CAS 1142214-62-7: (βS)-β-Cyclopropyl-3-[[2-(5,5-dimethyl-1-cyclopenten-1-yl)-2′-fluoro-5′-methoxy[1,1′-biphenyl]-4-yl]methoxy]benzenepropanoic acid

Description:(βS)-β-Cyclopropyl-3-[[2-(5,5-dimethyl-1-cyclopenten-1-yl)-2′-fluoro-5′-methoxy[1,1′-biphenyl]-4-yl]methoxy]benzenepropanoic acid, with CAS number 1142214-62-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a cyclopropyl group, a cyclopentene moiety, and a biphenyl system. This compound exhibits properties typical of pharmaceuticals, particularly in the context of its potential biological activity. It may interact with specific biological targets, making it of interest in medicinal chemistry. The presence of functional groups such as methoxy and fluoro substituents suggests that it may have enhanced lipophilicity and metabolic stability. Additionally, the stereochemistry indicated by the (βS) designation implies that the compound may exhibit chiral properties, which can influence its pharmacodynamics and pharmacokinetics. Overall, this compound's unique structural features may contribute to its potential applications in drug development, particularly in targeting specific receptors or pathways in biological systems.

Formula:C₃₃H₃₅FO₄

InChI:InChI=1S/C33H35FO4/c1-33(2)15-5-8-30(33)28-16-21(9-13-26(28)29-18-24(37-3)12-14-31(29)34)20-38-25-7-4-6-23(17-25)27(19-32(35)36)22-10-11-22/h4,6-9,12-14,16-18,22,27H,5,10-11,15,19-20H2,1-3H3,(H,35,36)/t27-/m0/s1

InChI key:InChIKey=CHEANNSDVJOIBS-MHZLTWQESA-N

SMILES:O=C(O)CC(C=1C=CC=C(OCC=2C=CC(C=3C=C(OC)C=CC3F)=C(C2)C4=CCCC4(C)C)C1)C5CC5

Found 3 products.

Product data	Purity	Price range	Estimated delivery
AM-1638 REF: IN-DA00HCUTCAS: 1142214-62-7	99.65%	To inquire	Mon 03 Mar 25
AM-1638 REF: 3D-SVB21462CAS: 1142214-62-7	Min. 95%	To inquire	Mon 14 Apr 25
AM-1638 REF: TM-T14200CAS: 1142214-62-7	- - -	95.00 €~1,654.00 €	Mon 05 May 25