CAS 1142214-69-4

2,2-Dimethyl-3-[[4-(2-pyrimidinyl)-1-piperazinyl]carbonyl]cyclopropanecarboxylic acid

Description:

2,2-Dimethyl-3-[[4-(2-pyrimidinyl)-1-piperazinyl]carbonyl]cyclopropanecarboxylic acid is a chemical compound characterized by its complex structure, which includes a cyclopropane ring, a carboxylic acid functional group, and a piperazine moiety substituted with a pyrimidine ring. This compound is typically classified as a pharmaceutical intermediate or a potential drug candidate due to its unique structural features that may confer specific biological activities. The presence of the piperazine and pyrimidine groups suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may influence its solubility, stability, and reactivity, which are critical factors in drug development. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including NMR, mass spectrometry, and possibly X-ray crystallography to confirm its structure. Overall, this compound exemplifies the complexity and diversity of organic molecules used in the development of therapeutic agents.

Formula: C₁₅H₂₀N₄O₃

InChI: InChI=1S/C15H20N4O3/c1-15(2)10(11(15)13(21)22)12(20)18-6-8-19(9-7-18)14-16-4-3-5-17-14/h3-5,10-11H,6-9H2,1-2H3,(H,21,22)

InChI key: InChIKey=RTOGGNKEKCMWCV-UHFFFAOYSA-N

SMILES: C(=O)(C1C(C(O)=O)C1(C)C)N2CCN(CC2)C=3N=CC=CN3

Synonyms:

• Cyclopropanecarboxylic acid, 2,2-dimethyl-3-[[4-(2-pyrimidinyl)-1-piperazinyl]carbonyl]-
• 2,2-Dimethyl-3-[[4-(2-pyrimidinyl)-1-piperazinyl]carbonyl]cyclopropanecarboxylic acid