CAS 1142214-71-8

2,2-Dimethyl-3-[[4-(2-pyridinyl)-1-piperazinyl]carbonyl]cyclopropanecarboxylic acid

Description:

2,2-Dimethyl-3-[[4-(2-pyridinyl)-1-piperazinyl]carbonyl]cyclopropanecarboxylic acid is a complex organic compound characterized by its unique structural features, including a cyclopropane ring and a piperazine moiety. This compound typically exhibits properties associated with both acidic and basic functional groups, allowing it to participate in various chemical reactions. The presence of the pyridine ring contributes to its potential for forming coordination complexes and enhances its solubility in polar solvents. The dimethyl substitution on the cyclopropane ring may influence its steric hindrance and reactivity. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Overall, this compound's unique characteristics make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₆H₂₁N₃O₃

InChI: InChI=1S/C16H21N3O3/c1-16(2)12(13(16)15(21)22)14(20)19-9-7-18(8-10-19)11-5-3-4-6-17-11/h3-6,12-13H,7-10H2,1-2H3,(H,21,22)

InChI key: InChIKey=WROYMWVTBFJMGA-UHFFFAOYSA-N

SMILES: C(=O)(C1C(C(O)=O)C1(C)C)N2CCN(CC2)C3=CC=CC=N3

Synonyms:

• 2,2-Dimethyl-3-[[4-(2-pyridinyl)-1-piperazinyl]carbonyl]cyclopropanecarboxylic acid
• Cyclopropanecarboxylic acid, 2,2-dimethyl-3-[[4-(2-pyridinyl)-1-piperazinyl]carbonyl]-