CymitQuimica logo

CAS 1142214-86-5

:

3-[[4-(2,5-Dimethylphenyl)-1-piperazinyl]carbonyl]-2,2-dimethylcyclopropanecarboxylic acid

Description:
3-[[4-(2,5-Dimethylphenyl)-1-piperazinyl]carbonyl]-2,2-dimethylcyclopropanecarboxylic acid is a complex organic compound characterized by its unique structural features, including a cyclopropane ring and a piperazine moiety. This compound typically exhibits properties associated with both acidic and basic functional groups, allowing it to participate in various chemical reactions. The presence of the dimethylphenyl group contributes to its hydrophobic characteristics, while the piperazine ring can enhance solubility in polar solvents. The compound may exhibit biological activity, potentially interacting with specific receptors or enzymes due to its structural similarity to pharmacologically active substances. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychological conditions. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry fields.
Formula:C19H26N2O3
InChI:InChI=1S/C19H26N2O3/c1-12-5-6-13(2)14(11-12)20-7-9-21(10-8-20)17(22)15-16(18(23)24)19(15,3)4/h5-6,11,15-16H,7-10H2,1-4H3,(H,23,24)
InChI key:InChIKey=GYWXTUMNJYZTFQ-UHFFFAOYSA-N
SMILES:C(=O)(C1C(C(O)=O)C1(C)C)N2CCN(CC2)C3=C(C)C=CC(C)=C3
Synonyms:
  • 3-[[4-(2,5-Dimethylphenyl)-1-piperazinyl]carbonyl]-2,2-dimethylcyclopropanecarboxylic acid
  • Cyclopropanecarboxylic acid, 3-[[4-(2,5-dimethylphenyl)-1-piperazinyl]carbonyl]-2,2-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.