CAS 1142214-97-8

2,2-Dimethyl-3-(1-pyrrolidinylcarbonyl)cyclopropanecarboxylic acid

Description:

2,2-Dimethyl-3-(1-pyrrolidinylcarbonyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique cyclopropane structure, which is a three-membered carbon ring. This compound features two methyl groups at the 2-position and a pyrrolidinylcarbonyl group at the 3-position, contributing to its potential biological activity. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. The pyrrolidinyl moiety suggests potential interactions with biological systems, possibly affecting its pharmacological properties. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could lead to specific interactions with biological targets. Its CAS number, 1142214-97-8, allows for precise identification in chemical databases, facilitating research and application in various fields, including organic synthesis and pharmaceutical development. Overall, the compound's unique structure and functional groups make it a subject of interest for further study in chemical and biological contexts.

Formula: C₁₁H₁₇NO₃

InChI: InChI=1S/C11H17NO3/c1-11(2)7(8(11)10(14)15)9(13)12-5-3-4-6-12/h7-8H,3-6H2,1-2H3,(H,14,15)

InChI key: InChIKey=DOGBPEZEHIVQRY-UHFFFAOYSA-N

SMILES: C(=O)(C1C(C(O)=O)C1(C)C)N2CCCC2

Synonyms:

• Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(1-pyrrolidinylcarbonyl)-
• 2,2-Dimethyl-3-(1-pyrrolidinylcarbonyl)cyclopropanecarboxylic acid