CAS 1142215-03-9

2,2-Dimethyl-3-(4-thiomorpholinylcarbonyl)cyclopropanecarboxylic acid

Description:

2,2-Dimethyl-3-(4-thiomorpholinylcarbonyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique cyclopropane structure, which is a three-membered carbon ring. The presence of two methyl groups at the 2-position contributes to its steric properties, while the 3-position features a substituent that includes a thiomorpholine moiety, which is a six-membered ring containing sulfur and nitrogen. This compound is likely to exhibit interesting biological activity due to the presence of the thiomorpholine group, which can influence its interaction with biological targets. The carboxylic acid functional group at the cyclopropane's 3-position provides acidic properties, allowing for potential solubility in polar solvents and participation in various chemical reactions, such as esterification or amidation. The compound's structural features suggest it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₁H₁₇NO₃S

InChI: InChI=1S/C11H17NO3S/c1-11(2)7(8(11)10(14)15)9(13)12-3-5-16-6-4-12/h7-8H,3-6H2,1-2H3,(H,14,15)

InChI key: InChIKey=PADFSQCARWKJKL-UHFFFAOYSA-N

SMILES: C(=O)(C1C(C(O)=O)C1(C)C)N2CCSCC2

Synonyms:

• Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(4-thiomorpholinylcarbonyl)-
• 2,2-Dimethyl-3-(4-thiomorpholinylcarbonyl)cyclopropanecarboxylic acid