CymitQuimica logo

CAS 1142215-07-3

:

2,2-Dimethyl-3-[[4-(phenylmethyl)-1-piperidinyl]carbonyl]cyclopropanecarboxylic acid

Description:
2,2-Dimethyl-3-[[4-(phenylmethyl)-1-piperidinyl]carbonyl]cyclopropanecarboxylic acid is a synthetic organic compound characterized by its complex structure, which includes a cyclopropane ring, a carboxylic acid functional group, and a piperidine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many carboxylic acids with bulky substituents. Its molecular structure suggests potential biological activity, particularly in pharmacology, where piperidine derivatives are often explored for their therapeutic effects. The presence of the phenylmethyl group may enhance lipophilicity, influencing its interaction with biological membranes. Additionally, the compound may exhibit specific stereochemical configurations due to the presence of chiral centers, which can significantly affect its biological activity and pharmacokinetics. Overall, 2,2-Dimethyl-3-[[4-(phenylmethyl)-1-piperidinyl]carbonyl]cyclopropanecarboxylic acid represents a class of compounds that could be of interest in medicinal chemistry and drug development.
Formula:C19H25NO3
InChI:InChI=1S/C19H25NO3/c1-19(2)15(16(19)18(22)23)17(21)20-10-8-14(9-11-20)12-13-6-4-3-5-7-13/h3-7,14-16H,8-12H2,1-2H3,(H,22,23)
InChI key:InChIKey=FHXXQBAKIWMBRW-UHFFFAOYSA-N
SMILES:C(=O)(C1C(C(O)=O)C1(C)C)N2CCC(CC3=CC=CC=C3)CC2
Synonyms:
  • Cyclopropanecarboxylic acid, 2,2-dimethyl-3-[[4-(phenylmethyl)-1-piperidinyl]carbonyl]-
  • 2,2-Dimethyl-3-[[4-(phenylmethyl)-1-piperidinyl]carbonyl]cyclopropanecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.