CAS 1142215-14-2
:3-[(3,4-Dihydro-2(1H)-isoquinolinyl)carbonyl]-2,2-dimethylcyclopropanecarboxylic acid
Description:
3-[(3,4-Dihydro-2(1H)-isoquinolinyl)carbonyl]-2,2-dimethylcyclopropanecarboxylic acid is a chemical compound characterized by its complex structure, which includes a cyclopropane ring and an isoquinoline moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the isoquinoline structure suggests potential biological activity, as isoquinolines are often associated with various pharmacological effects. The dimethyl substitution on the cyclopropane ring indicates steric hindrance, which may influence the compound's reactivity and interactions with biological targets. Additionally, the compound's molecular weight and specific stereochemistry can affect its solubility and bioavailability. Overall, this substance may be of interest in medicinal chemistry and drug development, particularly in the context of designing compounds with specific therapeutic properties. However, detailed studies would be necessary to fully elucidate its characteristics and potential applications.
Formula:C16H19NO3
InChI:InChI=1S/C16H19NO3/c1-16(2)12(13(16)15(19)20)14(18)17-8-7-10-5-3-4-6-11(10)9-17/h3-6,12-13H,7-9H2,1-2H3,(H,19,20)
InChI key:InChIKey=AJWIHWYZJUSPRK-UHFFFAOYSA-N
SMILES:C(=O)(C1C(C(O)=O)C1(C)C)N2CC=3C(CC2)=CC=CC3
Synonyms:- Cyclopropanecarboxylic acid, 3-[(3,4-dihydro-2(1H)-isoquinolinyl)carbonyl]-2,2-dimethyl-
- 3-[(3,4-Dihydro-2(1H)-isoquinolinyl)carbonyl]-2,2-dimethylcyclopropanecarboxylic acid
- 2,2-Dimethyl-3-(1,2,3,4-tetrahydroisoquinoline-2-carbonyl)cyclopropane-1-carboxylic acid
- 3-(3,4-dihydroisoquinolin-2(1H)-ylcarbonyl)-2,2-dimethylcyclopropanecarboxylic acid
- 3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-2,2-dimethylcyclopropane-1-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.