CymitQuimica logo

CAS 1142215-35-7

:

N-(4-Methoxyphenyl)-N-[2-[[2-(4-methoxyphenyl)ethyl]amino]-2-oxoethyl]glycine

Description:
N-(4-Methoxyphenyl)-N-[2-[[2-(4-methoxyphenyl)ethyl]amino]-2-oxoethyl]glycine, identified by its CAS number 1142215-35-7, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a complex structure characterized by the presence of methoxyphenyl groups, which contribute to its hydrophobic properties, and a glycine moiety that imparts basic amino acid characteristics. The compound is likely to exhibit moderate solubility in organic solvents due to its aromatic components, while its polar functional groups may enhance solubility in aqueous environments. Its potential applications could span various fields, including medicinal chemistry, where it may serve as a lead compound for drug development or as a biochemical probe. The presence of both amino and carbonyl functionalities suggests that it may participate in various chemical reactions, including peptide bond formation and other transformations typical of amino acid derivatives. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C20H24N2O5
InChI:InChI=1S/C20H24N2O5/c1-26-17-7-3-15(4-8-17)11-12-21-19(23)13-22(14-20(24)25)16-5-9-18(27-2)10-6-16/h3-10H,11-14H2,1-2H3,(H,21,23)(H,24,25)
InChI key:InChIKey=XRNLBYKYFPMJPK-UHFFFAOYSA-N
SMILES:N(CC(NCCC1=CC=C(OC)C=C1)=O)(CC(O)=O)C2=CC=C(OC)C=C2
Synonyms:
  • N-(4-Methoxyphenyl)-N-[2-[[2-(4-methoxyphenyl)ethyl]amino]-2-oxoethyl]glycine
  • Glycine, N-(4-methoxyphenyl)-N-[2-[[2-(4-methoxyphenyl)ethyl]amino]-2-oxoethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.