CymitQuimica logo

CAS 1142215-53-9

:

N-[2-[[2-(4-Fluorophenyl)ethyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine

Description:
N-[2-[[2-(4-Fluorophenyl)ethyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine, with CAS number 1142215-53-9, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a complex structure characterized by the presence of a glycine backbone, which is modified with an ethylamine side chain and a methoxyphenyl group. The incorporation of a fluorophenyl moiety enhances its potential biological activity, possibly influencing its pharmacological properties. The compound is likely to exhibit polar characteristics due to the presence of amino and carboxyl functional groups, which may affect its solubility and interaction with biological systems. Additionally, the methoxy group can influence the compound's lipophilicity and overall reactivity. While specific biological activities and applications may vary, compounds of this nature are often investigated for their potential roles in medicinal chemistry, particularly in the development of therapeutic agents targeting various diseases. Further studies would be necessary to elucidate its specific properties and potential uses.
Formula:C19H21FN2O4
InChI:InChI=1S/C19H21FN2O4/c1-26-17-8-6-16(7-9-17)22(13-19(24)25)12-18(23)21-11-10-14-2-4-15(20)5-3-14/h2-9H,10-13H2,1H3,(H,21,23)(H,24,25)
InChI key:InChIKey=SVATZDUKUSZOQP-UHFFFAOYSA-N
SMILES:N(CC(NCCC1=CC=C(F)C=C1)=O)(CC(O)=O)C2=CC=C(OC)C=C2
Synonyms:
  • Glycine, N-[2-[[2-(4-fluorophenyl)ethyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)-
  • N-[2-[[2-(4-Fluorophenyl)ethyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.