CAS 1142215-88-0

N-[2-[[(2,3-Dimethoxyphenyl)methyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine

Description:

N-[2-[[(2,3-Dimethoxyphenyl)methyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine, with CAS number 1142215-88-0, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a glycine backbone modified with a methoxyphenyl group and a dimethoxyphenyl moiety, which contribute to its unique chemical properties. The presence of the dimethoxyphenyl group suggests potential for interactions with biological targets, possibly influencing its pharmacological activity. The compound is characterized by its ability to form hydrogen bonds due to the amino and carboxyl functional groups, which may enhance its solubility in polar solvents. Additionally, the methoxy groups can affect the electronic properties of the molecule, potentially influencing its reactivity and interaction with other chemical species. While specific biological activities or applications may not be widely documented, compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. Further studies would be necessary to elucidate its full profile, including stability, solubility, and biological activity.

Formula: C₂₀H₂₄N₂O₆

InChI: InChI=1S/C20H24N2O6/c1-26-16-9-7-15(8-10-16)22(13-19(24)25)12-18(23)21-11-14-5-4-6-17(27-2)20(14)28-3/h4-10H,11-13H2,1-3H3,(H,21,23)(H,24,25)

InChI key: InChIKey=GJJBNXCXPKMKET-UHFFFAOYSA-N

SMILES: N(CC(NCC1=C(OC)C(OC)=CC=C1)=O)(CC(O)=O)C2=CC=C(OC)C=C2

Synonyms:

• N-[2-[[(2,3-Dimethoxyphenyl)methyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine
• Glycine, N-[2-[[(2,3-dimethoxyphenyl)methyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)-