CAS 114248-23-6: 2',2'-DIFLUORO-2'-DEOXYURIDINE
Description:2',2'-Difluoro-2'-deoxyuridine (CAS 114248-23-6) is a nucleoside analog that features two fluorine atoms substituted at the 2' position of the deoxyribose sugar moiety. This modification enhances its stability and alters its interaction with nucleic acid synthesis pathways. The compound is structurally related to deoxyuridine, a natural nucleoside, but the presence of fluorine atoms can influence its biological activity, potentially inhibiting viral replication or affecting cellular processes. 2',2'-Difluoro-2'-deoxyuridine is primarily studied for its potential therapeutic applications, particularly in antiviral and anticancer treatments, as it may interfere with DNA synthesis in rapidly dividing cells. Its solubility and stability in biological systems are critical for its efficacy as a drug candidate. Additionally, the compound's mechanism of action often involves incorporation into DNA, leading to chain termination or mispairing during replication. Overall, 2',2'-difluoro-2'-deoxyuridine represents a significant area of research in medicinal chemistry and pharmacology.
Formula:C9H10F2N2O5
InChI:InChI=1/C9H10F2N2O5/c10-9(11)6(16)4(3-14)18-7(9)13-2-1-5(15)12-8(13)17/h1-2,4,6-7,14,16H,3H2,(H,12,15,17)/t4-,6+,7-/m1/s1
- Synonyms:
- 2'-Deoxy-2,2'difluorouridine
- 2'-Deoxy-2',2'-difluoro-D-uridine
- 2',2'-Difluorodeoxyuridine
