CAS 114264-01-6
:methyl (3R)-3-benzyloxytetradecanoate
Description:
Methyl (3R)-3-benzyloxytetradecanoate is an ester compound characterized by its long carbon chain and the presence of a benzyloxy group. As a derivative of tetradecanoic acid, it features a 14-carbon fatty acid backbone, which contributes to its hydrophobic properties. The "3R" designation indicates the specific stereochemistry at the third carbon, which can influence the compound's biological activity and interactions. The benzyloxy group enhances the compound's lipophilicity and may affect its solubility in organic solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals or bioactive molecules. Its structure suggests potential applications in fields such as medicinal chemistry and materials science, where the unique properties of esters are exploited. Additionally, the presence of both hydrophobic and hydrophilic regions in its structure may allow for interesting interactions in biological systems, making it a subject of interest for further research.
Formula:C22H36O3
InChI:InChI=1/C22H36O3/c1-3-4-5-6-7-8-9-10-14-17-21(18-22(23)24-2)25-19-20-15-12-11-13-16-20/h11-13,15-16,21H,3-10,14,17-19H2,1-2H3/t21-/m1/s1
SMILES:CCCCCCCCCCC[C@H](CC(=O)OC)OCc1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Tetradecanoic acid, 3-(phenylmethoxy)-, methyl ester, (3R)-
CAS:Formula:C22H36O3Color and Shape:LiquidMolecular weight:348.5194(R)-3-Benzyloxy Myristic Acid Methyl Ester
CAS:Controlled ProductFormula:C22H36O3Color and Shape:NeatMolecular weight:348.52


