CymitQuimica logo

CAS 1142927-38-5

:

1,5-Naphthyridine-4-carbonitrile

Description:
1,5-Naphthyridine-4-carbonitrile is a heterocyclic organic compound characterized by its bicyclic structure, which consists of a naphthyridine ring system with a cyano group (-C≡N) attached at the 4-position. This compound typically exhibits properties associated with both aromaticity and basicity due to the presence of nitrogen atoms in the ring. It is often a pale yellow to light brown solid, with moderate solubility in polar organic solvents. The cyano group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the naphthyridine moiety can also impart biological activity, making it of interest in medicinal chemistry. Additionally, 1,5-naphthyridine derivatives are known for their potential as ligands in coordination chemistry and as precursors for various functional materials. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H5N3
InChI:InChI=1S/C9H5N3/c10-6-7-3-5-11-8-2-1-4-12-9(7)8/h1-5H
InChI key:InChIKey=OOUPKJJHWIZEJB-UHFFFAOYSA-N
SMILES:C(#N)C=1C2=C(N=CC1)C=CC=N2
Synonyms:
  • 1,5-Naphthyridine-4-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.