CAS 1142944-79-3

B-[4-[1-(Dimethylamino)ethyl]phenyl]boronic acid

Description:

B-[4-[1-(Dimethylamino)ethyl]phenyl]boronic acid, identified by its CAS number 1142944-79-3, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group and an amine substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The dimethylamino group enhances its solubility in organic solvents and may influence its reactivity and biological activity. Additionally, the compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Its stability, solubility, and reactivity can vary depending on the pH and the presence of other functional groups in a reaction environment. Overall, B-[4-[1-(Dimethylamino)ethyl]phenyl]boronic acid is a versatile compound with significant implications in chemical research and development.

Formula: C₁₀H₁₆BNO₂

InChI: InChI=1S/C10H16BNO2/c1-8(12(2)3)9-4-6-10(7-5-9)11(13)14/h4-8,13-14H,1-3H3

InChI key: InChIKey=JOQIQQHUDZSBAF-UHFFFAOYSA-N

SMILES: C(N(C)C)(C)C1=CC=C(B(O)O)C=C1

Synonyms:

• Boronic acid, B-[4-[1-(dimethylamino)ethyl]phenyl]-
• B-[4-[1-(Dimethylamino)ethyl]phenyl]boronic acid
• [4-[1-(Dimethylamino)ethyl]phenyl]boronic acid

(4-(1-(Dimethylamino)ethyl)phenyl)boronic acid

CAS: 1142944-79-3

Formula: C₁₀H₁₆BNO₂

Molecular weight: 193.0505

Ref: IN-DA0095HV