
CAS 1142946-81-3: B-(5-Cyanobenzo[b]thien-2-yl)boronic acid
Description:B-(5-Cyanobenzo[b]thien-2-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a cyanobenzo[b]thienyl moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the cyano group enhances its electronic properties, potentially increasing its reactivity and solubility in organic solvents. Additionally, the thienyl ring contributes to its aromatic character, which can influence its stability and interaction with other molecules. B-(5-Cyanobenzo[b]thien-2-yl)boronic acid may also exhibit fluorescence properties, making it valuable in the development of sensors or probes. Its unique structure allows for potential applications in drug discovery, particularly in the design of inhibitors targeting specific biological pathways. Overall, this compound represents a versatile building block in the field of organic and medicinal chemistry.
Formula:C9H6BNO2S
InChI:InChI=1S/C9H6BNO2S/c11-5-6-1-2-8-7(3-6)4-9(14-8)10(12)13/h1-4,12-13H
InChI key:InChIKey=DTOVRGIPWXMORK-UHFFFAOYSA-N
SMILES:N#CC=1C=CC=2SC(=CC2C1)B(O)O
- Synonyms:
- Boronic acid, B-(5-cyanobenzo[b]thien-2-yl)-
- (5-Cyano-1-benzothiophen-2-yl)boronic acid
- B-(5-Cyanobenzo[b]thien-2-yl)boronic acid
- (5-Cyanobenzo[b]thiophen-2-yl)boronicacid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Boronic acid, B-(5-cyanobenzo[b]thien-2-yl)- REF: IN-DA000AZVCAS: 1142946-81-3 | % | 124.00 €~594.00 € | Mon 10 Mar 25 |
![]() | (5-Cyanobenzo[b]thiophen-2-yl)boronic acid REF: 10-F766157CAS: 1142946-81-3 | 98% | 96.00 €~293.00 € | Tue 11 Mar 25 |
![]() | 5-Cyanobenzo[b]thiophene-2-boronic acid REF: 3D-SVB94681CAS: 1142946-81-3 | Min. 95% | - - - | Discontinued product |

Boronic acid, B-(5-cyanobenzo[b]thien-2-yl)-
Ref: IN-DA000AZV
1g | 594.00 € | ||
50mg | 124.00 € | ||
100mg | 196.00 € | ||
250mg | 238.00 € |

(5-Cyanobenzo[b]thiophen-2-yl)boronic acid
Ref: 10-F766157
1g | 293.00 € | ||
100mg | 96.00 € | ||
250mg | 107.00 € |

5-Cyanobenzo[b]thiophene-2-boronic acid
Ref: 3D-SVB94681
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |