CAS 114306-27-3
:4-Quinolinamine, 7-chloro-, hydrochloride (1:1)
Description:
4-Quinolinamine, 7-chloro-, hydrochloride (1:1) is a chemical compound characterized by its quinoline structure, which features a nitrogen atom within a bicyclic aromatic system. This compound is typically encountered as a hydrochloride salt, indicating that it is soluble in water and may exhibit different properties compared to its free base form. The presence of the chloro substituent at the 7-position of the quinoline ring can influence its reactivity and biological activity, potentially making it useful in medicinal chemistry. Compounds of this nature are often studied for their pharmacological properties, including antimicrobial and antitumor activities. The hydrochloride form enhances stability and solubility, making it easier to handle in laboratory settings. As with many nitrogen-containing heterocycles, 4-quinolinamine derivatives may participate in various chemical reactions, including electrophilic substitutions and complexation with metal ions. Safety data should be consulted when handling this substance, as it may pose health risks, including irritation or toxicity, depending on exposure levels.
Formula:C9H7ClN2·ClH
InChI:InChI=1S/C9H7ClN2.ClH/c10-6-1-2-7-8(11)3-4-12-9(7)5-6;/h1-5H,(H2,11,12);1H
InChI key:InChIKey=ZETPWLYXMPZNLA-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=C(Cl)C=C2)N=CC1.Cl
Synonyms:- Quinoline, 4-amino-7-chloro-, hydrochloride
- 4-Quinolinamine, 7-chloro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
