
CAS 114312-58-2
:Ethyl 2-(bromomethyl)-3-fluorobenzoate
Description:
Ethyl 2-(bromomethyl)-3-fluorobenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. This compound features a bromomethyl group and a fluorine atom attached to the aromatic ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom makes it a suitable candidate for nucleophilic substitution reactions, while the fluorine atom can influence the compound's electronic properties and stability. Ethyl 2-(bromomethyl)-3-fluorobenzoate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which facilitates its use in various chemical reactions. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals, owing to its functional groups that allow for further chemical modifications. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C10H10BrFO2
InChI:InChI=1S/C10H10BrFO2/c1-2-14-10(13)7-4-3-5-9(12)8(7)6-11/h3-5H,2,6H2,1H3
InChI key:InChIKey=HCTSRCSPFWZIGA-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(CBr)C(F)=CC=C1
Synonyms:- Ethyl 2-(bromomethyl)-3-fluorobenzoate
- Benzoic acid, 2-(bromomethyl)-3-fluoro-, ethyl ester
- 2-Bromomethyl-3-fluorobenzoic acid ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.