CAS 114341-88-7

3-(2-Bromo-1-oxopropyl)-4,4-dimethyl-2-oxazolidinone

Description:

3-(2-Bromo-1-oxopropyl)-4,4-dimethyl-2-oxazolidinone, with the CAS number 114341-88-7, is a chemical compound characterized by its oxazolidinone structure, which is a five-membered heterocyclic ring containing both nitrogen and oxygen atoms. This compound features a bromo substituent and a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the dimethyl groups enhances its steric properties, which can influence its interaction with other molecules. Typically, oxazolidinones are known for their role in medicinal chemistry, particularly as intermediates in the synthesis of various pharmaceuticals. The bromine atom may serve as a leaving group in nucleophilic substitution reactions, making this compound valuable in synthetic pathways. Additionally, the compound's stability and solubility characteristics can vary based on the solvent and conditions used, which is crucial for its application in laboratory settings. Overall, this compound exemplifies the complexity and utility of heterocyclic chemistry in developing new materials and pharmaceuticals.

Formula: C₈H₁₂BrNO₃

InChI: InChI=1S/C8H12BrNO3/c1-5(9)6(11)10-7(12)13-4-8(10,2)3/h5H,4H2,1-3H3

InChI key: InChIKey=MCVHDVANTPAEAA-UHFFFAOYSA-N

SMILES: C(C(Br)C)(=O)N1C(C)(C)COC1=O

Synonyms:

• 3-(2-Bromo-1-oxopropyl)-4,4-dimethyl-2-oxazolidinone
• 3-(2-Bromopropanoyl)-4,4-dimethyl-2-oxazolidinone
• 2-Oxazolidinone, 3-(2-bromo-1-oxopropyl)-4,4-dimethyl-

2-Oxazolidinone, 3-(2-bromo-1-oxopropyl)-4,4-dimethyl-

CAS: 114341-88-7

Formula: C₈H₁₂BrNO₃

Molecular weight: 250.0898

Ref: IN-DA000B40