CAS 1143461-33-9
:1-(4-Chloro-4-penten-1-yl)-2-methylbenzene
Description:
1-(4-Chloro-4-penten-1-yl)-2-methylbenzene, also known by its CAS number 1143461-33-9, is an organic compound characterized by its aromatic structure and the presence of both a chloroalkene and a methyl group. The compound features a benzene ring substituted with a 4-chloro-4-penten-1-yl group and a methyl group at the ortho position. This configuration contributes to its unique chemical properties, including potential reactivity due to the presence of the double bond in the pentenyl chain and the electronegative chlorine atom, which can influence the compound's polarity and reactivity. The compound may exhibit hydrophobic characteristics due to its aromatic nature, making it less soluble in water but more soluble in organic solvents. Its potential applications could span various fields, including organic synthesis and materials science, although specific uses would depend on further research into its reactivity and stability under different conditions. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C12H15Cl
InChI:InChI=1S/C12H15Cl/c1-10-6-3-4-8-12(10)9-5-7-11(2)13/h3-4,6,8H,2,5,7,9H2,1H3
InChI key:InChIKey=NHIYOJARNQCHFD-UHFFFAOYSA-N
SMILES:C(CCC(=C)Cl)C1=C(C)C=CC=C1
Synonyms:- 1-(4-Chloro-4-penten-1-yl)-2-methylbenzene
- Benzene, 1-(4-chloro-4-penten-1-yl)-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.