CAS 1143461-34-0
:1-(4-Bromo-4-penten-1-yl)-2-methylbenzene
Description:
1-(4-Bromo-4-penten-1-yl)-2-methylbenzene, also known as a substituted aromatic compound, features a brominated alkenyl group attached to a methyl-substituted benzene ring. This compound exhibits characteristics typical of both aromatic and aliphatic systems. The presence of the bromine atom introduces notable reactivity, particularly in electrophilic substitution reactions, while the alkenyl chain contributes to its potential for addition reactions. The compound's structure suggests it may have moderate polarity due to the bromine substituent, which can influence its solubility in various solvents. Additionally, the alkenyl group may allow for further functionalization, making it a versatile intermediate in organic synthesis. Its physical properties, such as boiling point and melting point, would be influenced by the molecular weight and the presence of the bromine atom. Overall, this compound's unique structure positions it as an interesting subject for study in fields such as medicinal chemistry and materials science.
Formula:C12H15Br
InChI:InChI=1S/C12H15Br/c1-10-6-3-4-8-12(10)9-5-7-11(2)13/h3-4,6,8H,2,5,7,9H2,1H3
InChI key:InChIKey=HXOIOIJKSOXRMB-UHFFFAOYSA-N
SMILES:C(CCC(Br)=C)C1=C(C)C=CC=C1
Synonyms:- 1-(4-Bromo-4-penten-1-yl)-2-methylbenzene
- Benzene, 1-(4-bromo-4-penten-1-yl)-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.